C18H24ClF3N4 — CID 111916053
1-[[1-(4-chlorophenyl)cyclopropyl]methyl]-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine (PubChem CID 111916053) has the molecular formula C18H24ClF3N4 and a molecular weight of 388.87 g/mol. Its IUPAC name is 1-[[1-(4-chlorophenyl)cyclopropyl]methyl]-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine.
| Compound Name | 1-[[1-(4-chlorophenyl)cyclopropyl]methyl]-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine |
|---|---|
| PubChem CID | 111916053 |
| Molecular Formula | C18H24ClF3N4 |
| Molecular Weight | 388.87 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 1-[[1-(4-chlorophenyl)cyclopropyl]methyl]-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine |
| SMILES | C/N=C(\NCC1(c2ccc(Cl)cc2)CC1)NC1CCN(CC(F)(F)F)C1 |
| InChI | InChI=1S/C18H24ClF3N4/c1-23-16(25-15-6-9-26(10-15)12-18(20,21)22)24-11-17(7-8-17)13-2-4-14(19)5-3-13/h2-5,15H,6-12H2,1H3,(H2,23,24,25) |
| InChIKey | XTCCIRBAVGWCQD-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.87 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|