C15H19ClF3N3 — CID 109473075
1-[[1-(4-chlorophenyl)cyclopropyl]methyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine (PubChem CID 109473075) has the molecular formula C15H19ClF3N3 and a molecular weight of 333.79 g/mol. Its IUPAC name is 1-[[1-(4-chlorophenyl)cyclopropyl]methyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine.
| Compound Name | 1-[[1-(4-chlorophenyl)cyclopropyl]methyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine |
|---|---|
| PubChem CID | 109473075 |
| Molecular Formula | C15H19ClF3N3 |
| Molecular Weight | 333.79 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | 1-[[1-(4-chlorophenyl)cyclopropyl]methyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine |
| SMILES | C/N=C(\NCCC(F)(F)F)NCC1(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C15H19ClF3N3/c1-20-13(21-9-8-15(17,18)19)22-10-14(6-7-14)11-2-4-12(16)5-3-11/h2-5H,6-10H2,1H3,(H2,20,21,22) |
| InChIKey | AWCBZCGHVOVRPE-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.79 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|