C13H25F3N4S — CID 111611688
2-methyl-1-(2-methyl-2-methylsulfanylpropyl)-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine (PubChem CID 111611688) has the molecular formula C13H25F3N4S and a molecular weight of 326.43 g/mol. Its IUPAC name is 2-methyl-1-(2-methyl-2-methylsulfanylpropyl)-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine.
| Compound Name | 2-methyl-1-(2-methyl-2-methylsulfanylpropyl)-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine |
|---|---|
| PubChem CID | 111611688 |
| Molecular Formula | C13H25F3N4S |
| Molecular Weight | 326.43 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | 2-methyl-1-(2-methyl-2-methylsulfanylpropyl)-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine |
| SMILES | C/N=C(\NCC(C)(C)SC)NC1CCN(CC(F)(F)F)C1 |
| InChI | InChI=1S/C13H25F3N4S/c1-12(2,21-4)8-18-11(17-3)19-10-5-6-20(7-10)9-13(14,15)16/h10H,5-9H2,1-4H3,(H2,17,18,19) |
| InChIKey | LXIXHUNBBYJGJF-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.43 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|