C18H25BrF3IN4 — CID 111650163
1-[[1-(2-bromophenyl)cyclopropyl]methyl]-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide (PubChem CID 111650163) has the molecular formula C18H25BrF3IN4 and a molecular weight of 561.23 g/mol. Its IUPAC name is 1-[[1-(2-bromophenyl)cyclopropyl]methyl]-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide.
| Compound Name | 1-[[1-(2-bromophenyl)cyclopropyl]methyl]-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111650163 |
| Molecular Formula | C18H25BrF3IN4 |
| Molecular Weight | 561.23 g/mol |
| Exact Mass | 560.03 |
| IUPAC Name | 1-[[1-(2-bromophenyl)cyclopropyl]methyl]-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCC1(c2ccccc2Br)CC1)NC1CCN(CC(F)(F)F)C1.I |
| InChI | InChI=1S/C18H24BrF3N4.HI/c1-23-16(25-13-6-9-26(10-13)12-18(20,21)22)24-11-17(7-8-17)14-4-2-3-5-15(14)19;/h2-5,13H,6-12H2,1H3,(H2,23,24,25);1H |
| InChIKey | JBZWGHXCVSICEQ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.23 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|