C16H26ClIN4O3S — CID 111735846
N-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-3-(methoxymethyl)-N'-methylpyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111735846) has the molecular formula C16H26ClIN4O3S and a molecular weight of 516.83 g/mol. Its IUPAC name is N-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-3-(methoxymethyl)-N'-methylpyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-3-(methoxymethyl)-N'-methylpyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111735846 |
| Molecular Formula | C16H26ClIN4O3S |
| Molecular Weight | 516.83 g/mol |
| Exact Mass | 516.05 |
| IUPAC Name | N-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-3-(methoxymethyl)-N'-methylpyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(/NCCNS(=O)(=O)c1cccc(Cl)c1)N1CCC(COC)C1.I |
| InChI | InChI=1S/C16H25ClN4O3S.HI/c1-18-16(21-9-6-13(11-21)12-24-2)19-7-8-20-25(22,23)15-5-3-4-14(17)10-15;/h3-5,10,13,20H,6-9,11-12H2,1-2H3,(H,18,19);1H |
| InChIKey | XCVMKEGBLPCKKC-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.83 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|