C17H29ClN4O3S — CID 111710031
1-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-3-(2-methoxy-3,3-dimethylbutyl)-2-methylguanidine (PubChem CID 111710031) has the molecular formula C17H29ClN4O3S and a molecular weight of 404.96 g/mol. Its IUPAC name is 1-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-3-(2-methoxy-3,3-dimethylbutyl)-2-methylguanidine.
| Compound Name | 1-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-3-(2-methoxy-3,3-dimethylbutyl)-2-methylguanidine |
|---|---|
| PubChem CID | 111710031 |
| Molecular Formula | C17H29ClN4O3S |
| Molecular Weight | 404.96 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | 1-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-3-(2-methoxy-3,3-dimethylbutyl)-2-methylguanidine |
| SMILES | C/N=C(/NCCNS(=O)(=O)c1cccc(Cl)c1)NCC(OC)C(C)(C)C |
| InChI | InChI=1S/C17H29ClN4O3S/c1-17(2,3)15(25-5)12-21-16(19-4)20-9-10-22-26(23,24)14-8-6-7-13(18)11-14/h6-8,11,15,22H,9-10,12H2,1-5H3,(H2,19,20,21) |
| InChIKey | QHGWDWPVCGJPOK-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.96 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|