C13H30N4O3S — CID 111709781
1-[2-(ethylsulfonylamino)ethyl]-3-(2-methoxy-3,3-dimethylbutyl)-2-methylguanidine (PubChem CID 111709781) has the molecular formula C13H30N4O3S and a molecular weight of 322.48 g/mol. Its IUPAC name is 1-[2-(ethylsulfonylamino)ethyl]-3-(2-methoxy-3,3-dimethylbutyl)-2-methylguanidine.
| Compound Name | 1-[2-(ethylsulfonylamino)ethyl]-3-(2-methoxy-3,3-dimethylbutyl)-2-methylguanidine |
|---|---|
| PubChem CID | 111709781 |
| Molecular Formula | C13H30N4O3S |
| Molecular Weight | 322.48 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | 1-[2-(ethylsulfonylamino)ethyl]-3-(2-methoxy-3,3-dimethylbutyl)-2-methylguanidine |
| SMILES | CCS(=O)(=O)NCCN/C(=N\C)NCC(OC)C(C)(C)C |
| InChI | InChI=1S/C13H30N4O3S/c1-7-21(18,19)17-9-8-15-12(14-5)16-10-11(20-6)13(2,3)4/h11,17H,7-10H2,1-6H3,(H2,14,15,16) |
| InChIKey | IPYUVKHMBRRPQF-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.48 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|