C15H32N4O2 — CID 111710045
3-[[N-(2-methoxy-3,3-dimethylbutyl)-N'-methylcarbamimidoyl]amino]-N-propan-2-ylpropanamide (PubChem CID 111710045) has the molecular formula C15H32N4O2 and a molecular weight of 300.45 g/mol. Its IUPAC name is 3-[[N-(2-methoxy-3,3-dimethylbutyl)-N'-methylcarbamimidoyl]amino]-N-propan-2-ylpropanamide.
| Compound Name | 3-[[N-(2-methoxy-3,3-dimethylbutyl)-N'-methylcarbamimidoyl]amino]-N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 111710045 |
| Molecular Formula | C15H32N4O2 |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.25 |
| IUPAC Name | 3-[[N-(2-methoxy-3,3-dimethylbutyl)-N'-methylcarbamimidoyl]amino]-N-propan-2-ylpropanamide |
| SMILES | C/N=C(\NCCC(=O)NC(C)C)NCC(OC)C(C)(C)C |
| InChI | InChI=1S/C15H32N4O2/c1-11(2)19-13(20)8-9-17-14(16-6)18-10-12(21-7)15(3,4)5/h11-12H,8-10H2,1-7H3,(H,19,20)(H2,16,17,18) |
| InChIKey | JWSQWCRYHXJCHZ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|