C18H29N3S — CID 133216801
1-(2,4-dimethylphenyl)-3-[3-(3-methylpiperidin-1-yl)propyl]thiourea (PubChem CID 133216801) has the molecular formula C18H29N3S and a molecular weight of 319.52 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-3-[3-(3-methylpiperidin-1-yl)propyl]thiourea.
| Compound Name | 1-(2,4-dimethylphenyl)-3-[3-(3-methylpiperidin-1-yl)propyl]thiourea |
|---|---|
| PubChem CID | 133216801 |
| Molecular Formula | C18H29N3S |
| Molecular Weight | 319.52 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-3-[3-(3-methylpiperidin-1-yl)propyl]thiourea |
| SMILES | Cc1ccc(NC(=S)NCCCN2CCCC(C)C2)c(C)c1 |
| InChI | InChI=1S/C18H29N3S/c1-14-7-8-17(16(3)12-14)20-18(22)19-9-5-11-21-10-4-6-15(2)13-21/h7-8,12,15H,4-6,9-11,13H2,1-3H3,(H2,19,20,22) |
| InChIKey | MCNWUHGQHKHTNS-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.52 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|