C21H24N4S — CID 100741079
1-[4-(cyanomethyl)phenyl]-3-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]thiourea (PubChem CID 100741079) has the molecular formula C21H24N4S and a molecular weight of 364.52 g/mol. Its IUPAC name is 1-[4-(cyanomethyl)phenyl]-3-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]thiourea.
| Compound Name | 1-[4-(cyanomethyl)phenyl]-3-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]thiourea |
|---|---|
| PubChem CID | 100741079 |
| Molecular Formula | C21H24N4S |
| Molecular Weight | 364.52 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | 1-[4-(cyanomethyl)phenyl]-3-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]thiourea |
| SMILES | N#CCc1ccc(NC(=S)NCCCN2CCc3ccccc3C2)cc1 |
| InChI | InChI=1S/C21H24N4S/c22-12-10-17-6-8-20(9-7-17)24-21(26)23-13-3-14-25-15-11-18-4-1-2-5-19(18)16-25/h1-2,4-9H,3,10-11,13-16H2,(H2,23,24,26) |
| InChIKey | RAZKUDSMWUVEJN-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 51.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.52 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|