C22H21N5O2S — CID 4306166
4-[(2,5-dimethylphenyl)diazenyl]-2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-5-methyl-1H-pyrazol-3-one (PubChem CID 4306166) has the molecular formula C22H21N5O2S and a molecular weight of 419.51 g/mol. Its IUPAC name is 4-[(2,5-dimethylphenyl)diazenyl]-2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-5-methyl-1H-pyrazol-3-one.
| Compound Name | 4-[(2,5-dimethylphenyl)diazenyl]-2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-5-methyl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 4306166 |
| Molecular Formula | C22H21N5O2S |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | 4-[(2,5-dimethylphenyl)diazenyl]-2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-5-methyl-1H-pyrazol-3-one |
| SMILES | COc1ccc(-c2csc(-n3[nH]c(C)c(/N=N/c4cc(C)ccc4C)c3=O)n2)cc1 |
| InChI | InChI=1S/C22H21N5O2S/c1-13-5-6-14(2)18(11-13)24-25-20-15(3)26-27(21(20)28)22-23-19(12-30-22)16-7-9-17(29-4)10-8-16/h5-12,26H,1-4H3/b25-24+ |
| InChIKey | OETDZLLLAIGDPL-OCOZRVBESA-N |
| XLogP | 5.64 |
| TPSA | 84.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|