C23H20FNO2 — CID 91793401
[2-(4-fluorophenyl)azetidin-1-yl]-[3-(2-methoxyphenyl)phenyl]methanone (PubChem CID 91793401) has the molecular formula C23H20FNO2 and a molecular weight of 361.42 g/mol. Its IUPAC name is [2-(4-fluorophenyl)azetidin-1-yl]-[3-(2-methoxyphenyl)phenyl]methanone.
| Compound Name | [2-(4-fluorophenyl)azetidin-1-yl]-[3-(2-methoxyphenyl)phenyl]methanone |
|---|---|
| PubChem CID | 91793401 |
| Molecular Formula | C23H20FNO2 |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | [2-(4-fluorophenyl)azetidin-1-yl]-[3-(2-methoxyphenyl)phenyl]methanone |
| SMILES | COc1ccccc1-c1cccc(C(=O)N2CCC2c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C23H20FNO2/c1-27-22-8-3-2-7-20(22)17-5-4-6-18(15-17)23(26)25-14-13-21(25)16-9-11-19(24)12-10-16/h2-12,15,21H,13-14H2,1H3 |
| InChIKey | FPCKNXOMXNSWPY-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |