C22H20N2O5S — CID 171906441
3-[3-[(4aR,7aS)-6,6-dioxo-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazine-4-carbonyl]phenyl]chromen-2-one (PubChem CID 171906441) has the molecular formula C22H20N2O5S and a molecular weight of 424.48 g/mol. Its IUPAC name is 3-[3-[(4aR,7aS)-6,6-dioxo-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazine-4-carbonyl]phenyl]chromen-2-one.
| Compound Name | 3-[3-[(4aR,7aS)-6,6-dioxo-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazine-4-carbonyl]phenyl]chromen-2-one |
|---|---|
| PubChem CID | 171906441 |
| Molecular Formula | C22H20N2O5S |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | 3-[3-[(4aR,7aS)-6,6-dioxo-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazine-4-carbonyl]phenyl]chromen-2-one |
| SMILES | O=C(c1cccc(-c2cc3ccccc3oc2=O)c1)N1CCN[C@@H]2CS(=O)(=O)C[C@@H]21 |
| InChI | InChI=1S/C22H20N2O5S/c25-21(24-9-8-23-18-12-30(27,28)13-19(18)24)16-6-3-5-14(10-16)17-11-15-4-1-2-7-20(15)29-22(17)26/h1-7,10-11,18-19,23H,8-9,12-13H2/t18-,19+/m1/s1 |
| InChIKey | OTPRHBWBUIFUOU-MOPGFXCFSA-N |
| XLogP | 1.67 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|