C27H22N4O5S — CID 17115765
3-nitro-N-[[3-(2-oxochromen-3-yl)phenyl]carbamothioyl]-4-pyrrolidin-1-ylbenzamide (PubChem CID 17115765) has the molecular formula C27H22N4O5S and a molecular weight of 514.56 g/mol. Its IUPAC name is 3-nitro-N-[[3-(2-oxochromen-3-yl)phenyl]carbamothioyl]-4-pyrrolidin-1-ylbenzamide.
| Compound Name | 3-nitro-N-[[3-(2-oxochromen-3-yl)phenyl]carbamothioyl]-4-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 17115765 |
| Molecular Formula | C27H22N4O5S |
| Molecular Weight | 514.56 g/mol |
| Exact Mass | 514.13 |
| IUPAC Name | 3-nitro-N-[[3-(2-oxochromen-3-yl)phenyl]carbamothioyl]-4-pyrrolidin-1-ylbenzamide |
| SMILES | O=C(NC(=S)Nc1cccc(-c2cc3ccccc3oc2=O)c1)c1ccc(N2CCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C27H22N4O5S/c32-25(19-10-11-22(23(16-19)31(34)35)30-12-3-4-13-30)29-27(37)28-20-8-5-7-17(14-20)21-15-18-6-1-2-9-24(18)36-26(21)33/h1-2,5-11,14-16H,3-4,12-13H2,(H2,28,29,32,37) |
| InChIKey | YDGXHMYQEWFMNN-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 117.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.56 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|