C29H29NO4 — CID 3126595
4-heptoxy-N-[3-(2-oxochromen-3-yl)phenyl]benzamide (PubChem CID 3126595) has the molecular formula C29H29NO4 and a molecular weight of 455.55 g/mol. Its IUPAC name is 4-heptoxy-N-[3-(2-oxochromen-3-yl)phenyl]benzamide.
| Compound Name | 4-heptoxy-N-[3-(2-oxochromen-3-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 3126595 |
| Molecular Formula | C29H29NO4 |
| Molecular Weight | 455.55 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | 4-heptoxy-N-[3-(2-oxochromen-3-yl)phenyl]benzamide |
| SMILES | CCCCCCCOc1ccc(C(=O)Nc2cccc(-c3cc4ccccc4oc3=O)c2)cc1 |
| InChI | InChI=1S/C29H29NO4/c1-2-3-4-5-8-18-33-25-16-14-21(15-17-25)28(31)30-24-12-9-11-22(19-24)26-20-23-10-6-7-13-27(23)34-29(26)32/h6-7,9-17,19-20H,2-5,8,18H2,1H3,(H,30,31) |
| InChIKey | ACBSWDJSGCMDTN-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.55 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|