C13H12O6 — CID 174954482
2-(3,5-dimethoxy-2-oxochromen-4-yl)acetic acid (PubChem CID 174954482) has the molecular formula C13H12O6 and a molecular weight of 264.23 g/mol. Its IUPAC name is 2-(3,5-dimethoxy-2-oxochromen-4-yl)acetic acid.
| Compound Name | 2-(3,5-dimethoxy-2-oxochromen-4-yl)acetic acid |
|---|---|
| PubChem CID | 174954482 |
| Molecular Formula | C13H12O6 |
| Molecular Weight | 264.23 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 2-(3,5-dimethoxy-2-oxochromen-4-yl)acetic acid |
| SMILES | COc1c(CC(=O)O)c2c(OC)cccc2oc1=O |
| InChI | InChI=1S/C13H12O6/c1-17-8-4-3-5-9-11(8)7(6-10(14)15)12(18-2)13(16)19-9/h3-5H,6H2,1-2H3,(H,14,15) |
| InChIKey | BBZCGVCIMHXALV-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.23 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|