C23H18N2O3 — CID 132514215
5-methoxy-N-phenyl-2-phenyliminochromene-3-carboxamide (PubChem CID 132514215) has the molecular formula C23H18N2O3 and a molecular weight of 370.41 g/mol. Its IUPAC name is 5-methoxy-N-phenyl-2-phenyliminochromene-3-carboxamide.
| Compound Name | 5-methoxy-N-phenyl-2-phenyliminochromene-3-carboxamide |
|---|---|
| PubChem CID | 132514215 |
| Molecular Formula | C23H18N2O3 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 5-methoxy-N-phenyl-2-phenyliminochromene-3-carboxamide |
| SMILES | COc1cccc2o/c(=N\c3ccccc3)c(C(=O)Nc3ccccc3)cc12 |
| InChI | InChI=1S/C23H18N2O3/c1-27-20-13-8-14-21-18(20)15-19(22(26)24-16-9-4-2-5-10-16)23(28-21)25-17-11-6-3-7-12-17/h2-15H,1H3,(H,24,26)/b25-23- |
| InChIKey | UIDUDWYLTBDRDY-BZZOAKBMSA-N |
| XLogP | 4.93 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |