C23H17ClN2O3 — CID 3577385
6-chloro-N-(3-methoxyphenyl)-2-phenyliminochromene-3-carboxamide (PubChem CID 3577385) has the molecular formula C23H17ClN2O3 and a molecular weight of 404.85 g/mol. Its IUPAC name is 6-chloro-N-(3-methoxyphenyl)-2-phenyliminochromene-3-carboxamide.
| Compound Name | 6-chloro-N-(3-methoxyphenyl)-2-phenyliminochromene-3-carboxamide |
|---|---|
| PubChem CID | 3577385 |
| Molecular Formula | C23H17ClN2O3 |
| Molecular Weight | 404.85 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | 6-chloro-N-(3-methoxyphenyl)-2-phenyliminochromene-3-carboxamide |
| SMILES | COc1cccc(NC(=O)c2cc3cc(Cl)ccc3o/c2=N\c2ccccc2)c1 |
| InChI | InChI=1S/C23H17ClN2O3/c1-28-19-9-5-8-18(14-19)25-22(27)20-13-15-12-16(24)10-11-21(15)29-23(20)26-17-6-3-2-4-7-17/h2-14H,1H3,(H,25,27)/b26-23- |
| InChIKey | QASJKSDFJAMADO-RWEWTDSWSA-N |
| XLogP | 5.58 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.85 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |