About CID 88536732
CID 88536732 (PubChem CID 88536732) has the molecular formula C12H7BO
and a molecular weight of 178.00 g/mol.
Molecular Properties
| Compound Name | CID 88536732 |
| PubChem CID | 88536732 |
| Molecular Formula | C12H7BO |
| Molecular Weight | 178.00 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | — |
| SMILES | [B]c1cccc2oc3ccccc3c12 |
| InChI | InChI=1S/C12H7BO/c13-9-5-3-7-11-12(9)8-4-1-2-6-10(8)14-11/h1-7H |
| InChIKey | HGVQVSHFWYKOCV-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.00 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 88536732 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 88536732?
The IUPAC name of CID 88536732 (CID 88536732) is not available.
What is the SMILES notation for CID 88536732?
The canonical SMILES for CID 88536732 is [B]c1cccc2oc3ccccc3c12.
What is the InChIKey of CID 88536732?
The InChIKey is HGVQVSHFWYKOCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7BO/c13-9-5-3-7-11-12(9)8-4-1-2-6-10(8)14-11/h1-7H.
What are the key properties of CID 88536732?
CID 88536732 has a molecular weight of 178.00 g/mol, XLogP of 2.38, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 88536732 is sourced from PubChem (CID 88536732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).