C15H11NO2 — CID 157355196
dibenzofuran;1,3-oxazole (PubChem CID 157355196) has the molecular formula C15H11NO2 and a molecular weight of 237.26 g/mol. Its IUPAC name is dibenzofuran;1,3-oxazole.
| Compound Name | dibenzofuran;1,3-oxazole |
|---|---|
| PubChem CID | 157355196 |
| Molecular Formula | C15H11NO2 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | dibenzofuran;1,3-oxazole |
| SMILES | c1ccc2c(c1)oc1ccccc12.c1cocn1 |
| InChI | InChI=1S/C12H8O.C3H3NO/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;1-2-5-3-4-1/h1-8H;1-3H |
| InChIKey | BHZPQNIAEHULTB-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 39.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |