C18H17NO — CID 58401033
2,4-bis(prop-1-en-2-yl)dibenzofuran-1-amine (PubChem CID 58401033) has the molecular formula C18H17NO and a molecular weight of 263.34 g/mol. Its IUPAC name is 2,4-bis(prop-1-en-2-yl)dibenzofuran-1-amine.
| Compound Name | 2,4-bis(prop-1-en-2-yl)dibenzofuran-1-amine |
|---|---|
| PubChem CID | 58401033 |
| Molecular Formula | C18H17NO |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 2,4-bis(prop-1-en-2-yl)dibenzofuran-1-amine |
| SMILES | C=C(C)c1cc(C(=C)C)c2oc3ccccc3c2c1N |
| InChI | InChI=1S/C18H17NO/c1-10(2)13-9-14(11(3)4)18-16(17(13)19)12-7-5-6-8-15(12)20-18/h5-9H,1,3,19H2,2,4H3 |
| InChIKey | OOEOLVOSYGLJMO-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|