C20H27NO — CID 144650095
2,4-di(propan-2-yl)dibenzofuran-1-amine;ethane (PubChem CID 144650095) has the molecular formula C20H27NO and a molecular weight of 297.44 g/mol. Its IUPAC name is 2,4-di(propan-2-yl)dibenzofuran-1-amine;ethane.
| Compound Name | 2,4-di(propan-2-yl)dibenzofuran-1-amine;ethane |
|---|---|
| PubChem CID | 144650095 |
| Molecular Formula | C20H27NO |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | 2,4-di(propan-2-yl)dibenzofuran-1-amine;ethane |
| SMILES | CC.CC(C)c1cc(C(C)C)c2oc3ccccc3c2c1N |
| InChI | InChI=1S/C18H21NO.C2H6/c1-10(2)13-9-14(11(3)4)18-16(17(13)19)12-7-5-6-8-15(12)20-18;1-2/h5-11H,19H2,1-4H3;1-2H3 |
| InChIKey | HRSRNYUTXJTUBP-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|