C17H20N2O3 — CID 68826676
3-[(4-amino-3-methyldibenzofuran-1-yl)-methylamino]propane-1,2-diol (PubChem CID 68826676) has the molecular formula C17H20N2O3 and a molecular weight of 300.36 g/mol. Its IUPAC name is 3-[(4-amino-3-methyldibenzofuran-1-yl)-methylamino]propane-1,2-diol.
| Compound Name | 3-[(4-amino-3-methyldibenzofuran-1-yl)-methylamino]propane-1,2-diol |
|---|---|
| PubChem CID | 68826676 |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 3-[(4-amino-3-methyldibenzofuran-1-yl)-methylamino]propane-1,2-diol |
| SMILES | Cc1cc(N(C)CC(O)CO)c2c(oc3ccccc32)c1N |
| InChI | InChI=1S/C17H20N2O3/c1-10-7-13(19(2)8-11(21)9-20)15-12-5-3-4-6-14(12)22-17(15)16(10)18/h3-7,11,20-21H,8-9,18H2,1-2H3 |
| InChIKey | QQCBEMXCOHCDHD-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|