C19H14O — CID 159538569
2-[(2,3,4,5,6-pentadeuteriophenyl)methyl]dibenzofuran (PubChem CID 159538569) has the molecular formula C19H14O and a molecular weight of 263.35 g/mol. Its IUPAC name is 2-[(2,3,4,5,6-pentadeuteriophenyl)methyl]dibenzofuran.
| Compound Name | 2-[(2,3,4,5,6-pentadeuteriophenyl)methyl]dibenzofuran |
|---|---|
| PubChem CID | 159538569 |
| Molecular Formula | C19H14O |
| Molecular Weight | 263.35 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 2-[(2,3,4,5,6-pentadeuteriophenyl)methyl]dibenzofuran |
| SMILES | [2H]c1c([2H])c([2H])c(Cc2ccc3oc4ccccc4c3c2)c([2H])c1[2H] |
| InChI | InChI=1S/C19H14O/c1-2-6-14(7-3-1)12-15-10-11-19-17(13-15)16-8-4-5-9-18(16)20-19/h1-11,13H,12H2/i1D,2D,3D,6D,7D |
| InChIKey | PPEMUKPVSUNUMG-FSTBWYLISA-N |
| XLogP | 5.18 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.35 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |