About 3-benzyldibenzofuran;hydrazine;methanimine
3-benzyldibenzofuran;hydrazine;methanimine (PubChem CID 142504911) has the molecular formula C20H21N3O
and a molecular weight of 319.41 g/mol. Its IUPAC name is 3-benzyldibenzofuran;hydrazine;methanimine.
Molecular Properties
| Compound Name | 3-benzyldibenzofuran;hydrazine;methanimine |
| PubChem CID | 142504911 |
| Molecular Formula | C20H21N3O |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | 3-benzyldibenzofuran;hydrazine;methanimine |
| SMILES | NN.[H]N=C.c1ccc(Cc2ccc3c(c2)oc2ccccc23)cc1 |
| InChI | InChI=1S/C19H14O.CH3N.H4N2/c1-2-6-14(7-3-1)12-15-10-11-17-16-8-4-5-9-18(16)20-19(17)13-15;2*1-2/h1-11,13H,12H2;2H,1H2;1-2H2 |
| InChIKey | SGXYOUUKBXLSAQ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-benzyldibenzofuran;hydrazine;methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyldibenzofuran;hydrazine;methanimine?
The IUPAC name of 3-benzyldibenzofuran;hydrazine;methanimine (CID 142504911) is 3-benzyldibenzofuran;hydrazine;methanimine.
What is the SMILES notation for 3-benzyldibenzofuran;hydrazine;methanimine?
The canonical SMILES for 3-benzyldibenzofuran;hydrazine;methanimine is NN.[H]N=C.c1ccc(Cc2ccc3c(c2)oc2ccccc23)cc1.
What is the InChIKey of 3-benzyldibenzofuran;hydrazine;methanimine?
The InChIKey is SGXYOUUKBXLSAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14O.CH3N.H4N2/c1-2-6-14(7-3-1)12-15-10-11-17-16-8-4-5-9-18(16)20-19(17)13-15;2*1-2/h1-11,13H,12H2;2H,1H2;1-2H2.
What are the key properties of 3-benzyldibenzofuran;hydrazine;methanimine?
3-benzyldibenzofuran;hydrazine;methanimine has a molecular weight of 319.41 g/mol, XLogP of 4.26, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyldibenzofuran;hydrazine;methanimine is sourced from PubChem (CID 142504911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).