About 1-[(E)-but-1-enyl]-2-propoxybenzene;methane
1-[(E)-but-1-enyl]-2-propoxybenzene;methane (PubChem CID 159219180) has the molecular formula C14H22O
and a molecular weight of 206.33 g/mol. Its IUPAC name is 1-[(E)-but-1-enyl]-2-propoxybenzene;methane.
Molecular Properties
| Compound Name | 1-[(E)-but-1-enyl]-2-propoxybenzene;methane |
| PubChem CID | 159219180 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | 1-[(E)-but-1-enyl]-2-propoxybenzene;methane |
| SMILES | C.CC/C=C/c1ccccc1OCCC |
| InChI | InChI=1S/C13H18O.CH4/c1-3-5-8-12-9-6-7-10-13(12)14-11-4-2;/h5-10H,3-4,11H2,1-2H3;1H4/b8-5+; |
| InChIKey | KRLSCOAMDVDIOJ-HAAWTFQLSA-N |
| XLogP | 4.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[(E)-but-1-enyl]-2-propoxybenzene;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E)-but-1-enyl]-2-propoxybenzene;methane?
The IUPAC name of 1-[(E)-but-1-enyl]-2-propoxybenzene;methane (CID 159219180) is 1-[(E)-but-1-enyl]-2-propoxybenzene;methane.
What is the SMILES notation for 1-[(E)-but-1-enyl]-2-propoxybenzene;methane?
The canonical SMILES for 1-[(E)-but-1-enyl]-2-propoxybenzene;methane is C.CC/C=C/c1ccccc1OCCC.
What is the InChIKey of 1-[(E)-but-1-enyl]-2-propoxybenzene;methane?
The InChIKey is KRLSCOAMDVDIOJ-HAAWTFQLSA-N. The full InChI is InChI=1S/C13H18O.CH4/c1-3-5-8-12-9-6-7-10-13(12)14-11-4-2;/h5-10H,3-4,11H2,1-2H3;1H4/b8-5+;.
What are the key properties of 1-[(E)-but-1-enyl]-2-propoxybenzene;methane?
1-[(E)-but-1-enyl]-2-propoxybenzene;methane has a molecular weight of 206.33 g/mol, XLogP of 4.53, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E)-but-1-enyl]-2-propoxybenzene;methane is sourced from PubChem (CID 159219180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).