About ethane;methylsulfanylmethane;naphthalene
ethane;methylsulfanylmethane;naphthalene (PubChem CID 91049231) has the molecular formula C14H20S
and a molecular weight of 220.38 g/mol. Its IUPAC name is ethane;methylsulfanylmethane;naphthalene.
Molecular Properties
| Compound Name | ethane;methylsulfanylmethane;naphthalene |
| PubChem CID | 91049231 |
| Molecular Formula | C14H20S |
| Molecular Weight | 220.38 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | ethane;methylsulfanylmethane;naphthalene |
| SMILES | CC.CSC.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8.C2H6S.C2H6/c1-2-6-10-8-4-3-7-9(10)5-1;1-3-2;1-2/h1-8H;1-2H3;1-2H3 |
| InChIKey | BOQICQZJLGXRLE-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.38 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;methylsulfanylmethane;naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methylsulfanylmethane;naphthalene?
The IUPAC name of ethane;methylsulfanylmethane;naphthalene (CID 91049231) is ethane;methylsulfanylmethane;naphthalene.
What is the SMILES notation for ethane;methylsulfanylmethane;naphthalene?
The canonical SMILES for ethane;methylsulfanylmethane;naphthalene is CC.CSC.c1ccc2ccccc2c1.
What is the InChIKey of ethane;methylsulfanylmethane;naphthalene?
The InChIKey is BOQICQZJLGXRLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8.C2H6S.C2H6/c1-2-6-10-8-4-3-7-9(10)5-1;1-3-2;1-2/h1-8H;1-2H3;1-2H3.
What are the key properties of ethane;methylsulfanylmethane;naphthalene?
ethane;methylsulfanylmethane;naphthalene has a molecular weight of 220.38 g/mol, XLogP of 4.85, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methylsulfanylmethane;naphthalene is sourced from PubChem (CID 91049231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).