C27H34O — CID 174805048
1-benzyl-2,3-dibutylbenzene;phenol (PubChem CID 174805048) has the molecular formula C27H34O and a molecular weight of 374.57 g/mol. Its IUPAC name is 1-benzyl-2,3-dibutylbenzene;phenol.
| Compound Name | 1-benzyl-2,3-dibutylbenzene;phenol |
|---|---|
| PubChem CID | 174805048 |
| Molecular Formula | C27H34O |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.26 |
| IUPAC Name | 1-benzyl-2,3-dibutylbenzene;phenol |
| SMILES | CCCCc1cccc(Cc2ccccc2)c1CCCC.Oc1ccccc1 |
| InChI | InChI=1S/C21H28.C6H6O/c1-3-5-13-19-14-10-15-20(21(19)16-6-4-2)17-18-11-8-7-9-12-18;7-6-4-2-1-3-5-6/h7-12,14-15H,3-6,13,16-17H2,1-2H3;1-5,7H |
| InChIKey | AZAVKFXVAHWJNI-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |