C20H21N5O3S — CID 56535103
methyl 3-[[2-(1-cyclopentyltetrazol-5-yl)sulfanylacetyl]amino]naphthalene-2-carboxylate (PubChem CID 56535103) has the molecular formula C20H21N5O3S and a molecular weight of 411.49 g/mol. Its IUPAC name is methyl 3-[[2-(1-cyclopentyltetrazol-5-yl)sulfanylacetyl]amino]naphthalene-2-carboxylate.
| Compound Name | methyl 3-[[2-(1-cyclopentyltetrazol-5-yl)sulfanylacetyl]amino]naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 56535103 |
| Molecular Formula | C20H21N5O3S |
| Molecular Weight | 411.49 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | methyl 3-[[2-(1-cyclopentyltetrazol-5-yl)sulfanylacetyl]amino]naphthalene-2-carboxylate |
| SMILES | COC(=O)c1cc2ccccc2cc1NC(=O)CSc1nnnn1C1CCCC1 |
| InChI | InChI=1S/C20H21N5O3S/c1-28-19(27)16-10-13-6-2-3-7-14(13)11-17(16)21-18(26)12-29-20-22-23-24-25(20)15-8-4-5-9-15/h2-3,6-7,10-11,15H,4-5,8-9,12H2,1H3,(H,21,26) |
| InChIKey | GXKACAPUPDZMQE-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.49 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |