C17H18N6OS — CID 60555012
2-(1-cyclopentyltetrazol-5-yl)sulfanyl-N-quinolin-6-ylacetamide (PubChem CID 60555012) has the molecular formula C17H18N6OS and a molecular weight of 354.44 g/mol. Its IUPAC name is 2-(1-cyclopentyltetrazol-5-yl)sulfanyl-N-quinolin-6-ylacetamide.
| Compound Name | 2-(1-cyclopentyltetrazol-5-yl)sulfanyl-N-quinolin-6-ylacetamide |
|---|---|
| PubChem CID | 60555012 |
| Molecular Formula | C17H18N6OS |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | 2-(1-cyclopentyltetrazol-5-yl)sulfanyl-N-quinolin-6-ylacetamide |
| SMILES | O=C(CSc1nnnn1C1CCCC1)Nc1ccc2ncccc2c1 |
| InChI | InChI=1S/C17H18N6OS/c24-16(19-13-7-8-15-12(10-13)4-3-9-18-15)11-25-17-20-21-22-23(17)14-5-1-2-6-14/h3-4,7-10,14H,1-2,5-6,11H2,(H,19,24) |
| InChIKey | GHTXQHNAJAKSGB-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |