C15H19N5O2S — CID 32581346
2-(1-cyclopentyltetrazol-5-yl)sulfanyl-N-phenylmethoxyacetamide (PubChem CID 32581346) has the molecular formula C15H19N5O2S and a molecular weight of 333.42 g/mol. Its IUPAC name is 2-(1-cyclopentyltetrazol-5-yl)sulfanyl-N-phenylmethoxyacetamide.
| Compound Name | 2-(1-cyclopentyltetrazol-5-yl)sulfanyl-N-phenylmethoxyacetamide |
|---|---|
| PubChem CID | 32581346 |
| Molecular Formula | C15H19N5O2S |
| Molecular Weight | 333.42 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 2-(1-cyclopentyltetrazol-5-yl)sulfanyl-N-phenylmethoxyacetamide |
| SMILES | O=C(CSc1nnnn1C1CCCC1)NOCc1ccccc1 |
| InChI | InChI=1S/C15H19N5O2S/c21-14(17-22-10-12-6-2-1-3-7-12)11-23-15-16-18-19-20(15)13-8-4-5-9-13/h1-3,6-7,13H,4-5,8-11H2,(H,17,21) |
| InChIKey | YNOYXACBRXNISF-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.42 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|