C16H19N5O3S — CID 25437754
methyl (2S)-2-[[2-(1-cyclopropyltetrazol-5-yl)sulfanylacetyl]amino]-3-phenylpropanoate (PubChem CID 25437754) has the molecular formula C16H19N5O3S and a molecular weight of 361.43 g/mol. Its IUPAC name is methyl (2S)-2-[[2-(1-cyclopropyltetrazol-5-yl)sulfanylacetyl]amino]-3-phenylpropanoate.
| Compound Name | methyl (2S)-2-[[2-(1-cyclopropyltetrazol-5-yl)sulfanylacetyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 25437754 |
| Molecular Formula | C16H19N5O3S |
| Molecular Weight | 361.43 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | methyl (2S)-2-[[2-(1-cyclopropyltetrazol-5-yl)sulfanylacetyl]amino]-3-phenylpropanoate |
| SMILES | COC(=O)[C@H](Cc1ccccc1)NC(=O)CSc1nnnn1C1CC1 |
| InChI | InChI=1S/C16H19N5O3S/c1-24-15(23)13(9-11-5-3-2-4-6-11)17-14(22)10-25-16-18-19-20-21(16)12-7-8-12/h2-6,12-13H,7-10H2,1H3,(H,17,22)/t13-/m0/s1 |
| InChIKey | PGHSQPIKGRCFHO-ZDUSSCGKSA-N |
| XLogP | 1.00 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.43 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |