C10H15N5O4S — CID 43422824
methyl 2-[[2-(1-cyclopropyltetrazol-5-yl)sulfanylacetyl]amino]-3-hydroxypropanoate (PubChem CID 43422824) has the molecular formula C10H15N5O4S and a molecular weight of 301.33 g/mol. Its IUPAC name is methyl 2-[[2-(1-cyclopropyltetrazol-5-yl)sulfanylacetyl]amino]-3-hydroxypropanoate.
| Compound Name | methyl 2-[[2-(1-cyclopropyltetrazol-5-yl)sulfanylacetyl]amino]-3-hydroxypropanoate |
|---|---|
| PubChem CID | 43422824 |
| Molecular Formula | C10H15N5O4S |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | methyl 2-[[2-(1-cyclopropyltetrazol-5-yl)sulfanylacetyl]amino]-3-hydroxypropanoate |
| SMILES | COC(=O)C(CO)NC(=O)CSc1nnnn1C1CC1 |
| InChI | InChI=1S/C10H15N5O4S/c1-19-9(18)7(4-16)11-8(17)5-20-10-12-13-14-15(10)6-2-3-6/h6-7,16H,2-5H2,1H3,(H,11,17) |
| InChIKey | FVLGPDLTRDZIQB-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 119.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |