C11H19N5O2S — CID 115884717
2-(1-cyclopropyltetrazol-5-yl)sulfanyl-N-(3-hydroxy-2-methylbutan-2-yl)acetamide (PubChem CID 115884717) has the molecular formula C11H19N5O2S and a molecular weight of 285.37 g/mol. Its IUPAC name is 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-N-(3-hydroxy-2-methylbutan-2-yl)acetamide.
| Compound Name | 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-N-(3-hydroxy-2-methylbutan-2-yl)acetamide |
|---|---|
| PubChem CID | 115884717 |
| Molecular Formula | C11H19N5O2S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-N-(3-hydroxy-2-methylbutan-2-yl)acetamide |
| SMILES | CC(O)C(C)(C)NC(=O)CSc1nnnn1C1CC1 |
| InChI | InChI=1S/C11H19N5O2S/c1-7(17)11(2,3)12-9(18)6-19-10-13-14-15-16(10)8-4-5-8/h7-8,17H,4-6H2,1-3H3,(H,12,18) |
| InChIKey | WJTLPIDRGXELKQ-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |