C7H11N5O2S — CID 30907405
2-(1-cyclopropyltetrazol-5-yl)sulfanyl-N-methoxyacetamide (PubChem CID 30907405) has the molecular formula C7H11N5O2S and a molecular weight of 229.26 g/mol. Its IUPAC name is 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-N-methoxyacetamide.
| Compound Name | 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-N-methoxyacetamide |
|---|---|
| PubChem CID | 30907405 |
| Molecular Formula | C7H11N5O2S |
| Molecular Weight | 229.26 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-N-methoxyacetamide |
| SMILES | CONC(=O)CSc1nnnn1C1CC1 |
| InChI | InChI=1S/C7H11N5O2S/c1-14-9-6(13)4-15-7-8-10-11-12(7)5-2-3-5/h5H,2-4H2,1H3,(H,9,13) |
| InChIKey | FNJLFNKXVCCCBP-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.26 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|