C10H16N6O3S — CID 27096512
2-(1-cyclopropyltetrazol-5-yl)sulfanyl-N-(2-methoxyethylcarbamoyl)acetamide (PubChem CID 27096512) has the molecular formula C10H16N6O3S and a molecular weight of 300.34 g/mol. Its IUPAC name is 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-N-(2-methoxyethylcarbamoyl)acetamide.
| Compound Name | 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-N-(2-methoxyethylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 27096512 |
| Molecular Formula | C10H16N6O3S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-N-(2-methoxyethylcarbamoyl)acetamide |
| SMILES | COCCNC(=O)NC(=O)CSc1nnnn1C1CC1 |
| InChI | InChI=1S/C10H16N6O3S/c1-19-5-4-11-9(18)12-8(17)6-20-10-13-14-15-16(10)7-2-3-7/h7H,2-6H2,1H3,(H2,11,12,17,18) |
| InChIKey | KNNIQKIEZCWYFJ-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 111.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|