C11H20N4O2S — CID 47124210
tert-butyl 2-(1-tert-butyltetrazol-5-yl)sulfanylacetate (PubChem CID 47124210) has the molecular formula C11H20N4O2S and a molecular weight of 272.37 g/mol. Its IUPAC name is tert-butyl 2-(1-tert-butyltetrazol-5-yl)sulfanylacetate.
| Compound Name | tert-butyl 2-(1-tert-butyltetrazol-5-yl)sulfanylacetate |
|---|---|
| PubChem CID | 47124210 |
| Molecular Formula | C11H20N4O2S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | tert-butyl 2-(1-tert-butyltetrazol-5-yl)sulfanylacetate |
| SMILES | CC(C)(C)OC(=O)CSc1nnnn1C(C)(C)C |
| InChI | InChI=1S/C11H20N4O2S/c1-10(2,3)15-9(12-13-14-15)18-7-8(16)17-11(4,5)6/h7H2,1-6H3 |
| InChIKey | GMUXJRZJGORPIX-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |