C20H27N3O2S — CID 17495105
2-(1-cyclopentyl-4,5-dimethylimidazol-2-yl)sulfanyl-N-(2-phenoxyethyl)acetamide (PubChem CID 17495105) has the molecular formula C20H27N3O2S and a molecular weight of 373.52 g/mol. Its IUPAC name is 2-(1-cyclopentyl-4,5-dimethylimidazol-2-yl)sulfanyl-N-(2-phenoxyethyl)acetamide.
| Compound Name | 2-(1-cyclopentyl-4,5-dimethylimidazol-2-yl)sulfanyl-N-(2-phenoxyethyl)acetamide |
|---|---|
| PubChem CID | 17495105 |
| Molecular Formula | C20H27N3O2S |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 2-(1-cyclopentyl-4,5-dimethylimidazol-2-yl)sulfanyl-N-(2-phenoxyethyl)acetamide |
| SMILES | Cc1nc(SCC(=O)NCCOc2ccccc2)n(C2CCCC2)c1C |
| InChI | InChI=1S/C20H27N3O2S/c1-15-16(2)23(17-8-6-7-9-17)20(22-15)26-14-19(24)21-12-13-25-18-10-4-3-5-11-18/h3-5,10-11,17H,6-9,12-14H2,1-2H3,(H,21,24) |
| InChIKey | UVQFDQVQDQVJEH-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|