C18H26N6OS — CID 39642004
2-(1-cyclopropyltetrazol-5-yl)sulfanyl-N-[[4-(diethylaminomethyl)phenyl]methyl]acetamide (PubChem CID 39642004) has the molecular formula C18H26N6OS and a molecular weight of 374.51 g/mol. Its IUPAC name is 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-N-[[4-(diethylaminomethyl)phenyl]methyl]acetamide.
| Compound Name | 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-N-[[4-(diethylaminomethyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 39642004 |
| Molecular Formula | C18H26N6OS |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-N-[[4-(diethylaminomethyl)phenyl]methyl]acetamide |
| SMILES | CCN(CC)Cc1ccc(CNC(=O)CSc2nnnn2C2CC2)cc1 |
| InChI | InChI=1S/C18H26N6OS/c1-3-23(4-2)12-15-7-5-14(6-8-15)11-19-17(25)13-26-18-20-21-22-24(18)16-9-10-16/h5-8,16H,3-4,9-13H2,1-2H3,(H,19,25) |
| InChIKey | QIDAXVZSXJHHBX-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |