C20H13BrN2O4S — CID 162668686
3-(4-bromophenyl)-2-[(5-hydroxy-4-oxopyran-2-yl)methylsulfanyl]quinazolin-4-one (PubChem CID 162668686) has the molecular formula C20H13BrN2O4S and a molecular weight of 457.31 g/mol. Its IUPAC name is 3-(4-bromophenyl)-2-[(5-hydroxy-4-oxopyran-2-yl)methylsulfanyl]quinazolin-4-one.
| Compound Name | 3-(4-bromophenyl)-2-[(5-hydroxy-4-oxopyran-2-yl)methylsulfanyl]quinazolin-4-one |
|---|---|
| PubChem CID | 162668686 |
| Molecular Formula | C20H13BrN2O4S |
| Molecular Weight | 457.31 g/mol |
| Exact Mass | 455.98 |
| IUPAC Name | 3-(4-bromophenyl)-2-[(5-hydroxy-4-oxopyran-2-yl)methylsulfanyl]quinazolin-4-one |
| SMILES | O=c1cc(CSc2nc3ccccc3c(=O)n2-c2ccc(Br)cc2)occ1O |
| InChI | InChI=1S/C20H13BrN2O4S/c21-12-5-7-13(8-6-12)23-19(26)15-3-1-2-4-16(15)22-20(23)28-11-14-9-17(24)18(25)10-27-14/h1-10,25H,11H2 |
| InChIKey | PTEULUJAPZJZJS-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.31 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |