C25H23BrN2OS — CID 4253650
2-[(4-bromophenyl)methylsulfanyl]-3-(4-butan-2-ylphenyl)quinazolin-4-one (PubChem CID 4253650) has the molecular formula C25H23BrN2OS and a molecular weight of 479.44 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methylsulfanyl]-3-(4-butan-2-ylphenyl)quinazolin-4-one.
| Compound Name | 2-[(4-bromophenyl)methylsulfanyl]-3-(4-butan-2-ylphenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 4253650 |
| Molecular Formula | C25H23BrN2OS |
| Molecular Weight | 479.44 g/mol |
| Exact Mass | 478.07 |
| IUPAC Name | 2-[(4-bromophenyl)methylsulfanyl]-3-(4-butan-2-ylphenyl)quinazolin-4-one |
| SMILES | CCC(C)c1ccc(-n2c(SCc3ccc(Br)cc3)nc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C25H23BrN2OS/c1-3-17(2)19-10-14-21(15-11-19)28-24(29)22-6-4-5-7-23(22)27-25(28)30-16-18-8-12-20(26)13-9-18/h4-15,17H,3,16H2,1-2H3 |
| InChIKey | BEWCETULIONEQU-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.44 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |