C24H29N3O2S — CID 7907724
2-[3-[4-[(2R)-butan-2-yl]phenyl]-4-oxoquinazolin-2-yl]sulfanyl-N-tert-butylacetamide (PubChem CID 7907724) has the molecular formula C24H29N3O2S and a molecular weight of 423.58 g/mol. Its IUPAC name is 2-[3-[4-[(2R)-butan-2-yl]phenyl]-4-oxoquinazolin-2-yl]sulfanyl-N-tert-butylacetamide.
| Compound Name | 2-[3-[4-[(2R)-butan-2-yl]phenyl]-4-oxoquinazolin-2-yl]sulfanyl-N-tert-butylacetamide |
|---|---|
| PubChem CID | 7907724 |
| Molecular Formula | C24H29N3O2S |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | 2-[3-[4-[(2R)-butan-2-yl]phenyl]-4-oxoquinazolin-2-yl]sulfanyl-N-tert-butylacetamide |
| SMILES | CC[C@@H](C)c1ccc(-n2c(SCC(=O)NC(C)(C)C)nc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C24H29N3O2S/c1-6-16(2)17-11-13-18(14-12-17)27-22(29)19-9-7-8-10-20(19)25-23(27)30-15-21(28)26-24(3,4)5/h7-14,16H,6,15H2,1-5H3,(H,26,28)/t16-/m1/s1 |
| InChIKey | DAXIWJLZYKOXAD-MRXNPFEDSA-N |
| XLogP | 4.91 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |