C17H14N2O6S — CID 91962399
(5-hydroxy-4-oxopyran-2-yl)methyl 2-(3-methyl-4-oxoquinazolin-2-yl)sulfanylacetate (PubChem CID 91962399) has the molecular formula C17H14N2O6S and a molecular weight of 374.37 g/mol. Its IUPAC name is (5-hydroxy-4-oxopyran-2-yl)methyl 2-(3-methyl-4-oxoquinazolin-2-yl)sulfanylacetate.
| Compound Name | (5-hydroxy-4-oxopyran-2-yl)methyl 2-(3-methyl-4-oxoquinazolin-2-yl)sulfanylacetate |
|---|---|
| PubChem CID | 91962399 |
| Molecular Formula | C17H14N2O6S |
| Molecular Weight | 374.37 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | (5-hydroxy-4-oxopyran-2-yl)methyl 2-(3-methyl-4-oxoquinazolin-2-yl)sulfanylacetate |
| SMILES | Cn1c(SCC(=O)OCc2cc(=O)c(O)co2)nc2ccccc2c1=O |
| InChI | InChI=1S/C17H14N2O6S/c1-19-16(23)11-4-2-3-5-12(11)18-17(19)26-9-15(22)25-7-10-6-13(20)14(21)8-24-10/h2-6,8,21H,7,9H2,1H3 |
| InChIKey | CFFLLGZOPCQYLL-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.37 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |