C19H15ClN2O3S — CID 2081713
7-chloro-3-(4-methylphenyl)-2-[(3S)-2-oxooxolan-3-yl]sulfanylquinazolin-4-one (PubChem CID 2081713) has the molecular formula C19H15ClN2O3S and a molecular weight of 386.86 g/mol. Its IUPAC name is 7-chloro-3-(4-methylphenyl)-2-[(3S)-2-oxooxolan-3-yl]sulfanylquinazolin-4-one.
| Compound Name | 7-chloro-3-(4-methylphenyl)-2-[(3S)-2-oxooxolan-3-yl]sulfanylquinazolin-4-one |
|---|---|
| PubChem CID | 2081713 |
| Molecular Formula | C19H15ClN2O3S |
| Molecular Weight | 386.86 g/mol |
| Exact Mass | 386.05 |
| IUPAC Name | 7-chloro-3-(4-methylphenyl)-2-[(3S)-2-oxooxolan-3-yl]sulfanylquinazolin-4-one |
| SMILES | Cc1ccc(-n2c(S[C@H]3CCOC3=O)nc3cc(Cl)ccc3c2=O)cc1 |
| InChI | InChI=1S/C19H15ClN2O3S/c1-11-2-5-13(6-3-11)22-17(23)14-7-4-12(20)10-15(14)21-19(22)26-16-8-9-25-18(16)24/h2-7,10,16H,8-9H2,1H3/t16-/m0/s1 |
| InChIKey | KZFOCIDFXYEGLJ-INIZCTEOSA-N |
| XLogP | 3.76 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.86 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |