C18H15N3O3S — CID 42884625
3-(4-methyl-2-pyridinyl)-2-(2-oxooxolan-3-yl)sulfanylquinazolin-4-one (PubChem CID 42884625) has the molecular formula C18H15N3O3S and a molecular weight of 353.40 g/mol. Its IUPAC name is 3-(4-methyl-2-pyridinyl)-2-(2-oxooxolan-3-yl)sulfanylquinazolin-4-one.
| Compound Name | 3-(4-methyl-2-pyridinyl)-2-(2-oxooxolan-3-yl)sulfanylquinazolin-4-one |
|---|---|
| PubChem CID | 42884625 |
| Molecular Formula | C18H15N3O3S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | 3-(4-methyl-2-pyridinyl)-2-(2-oxooxolan-3-yl)sulfanylquinazolin-4-one |
| SMILES | Cc1ccnc(-n2c(SC3CCOC3=O)nc3ccccc3c2=O)c1 |
| InChI | InChI=1S/C18H15N3O3S/c1-11-6-8-19-15(10-11)21-16(22)12-4-2-3-5-13(12)20-18(21)25-14-7-9-24-17(14)23/h2-6,8,10,14H,7,9H2,1H3 |
| InChIKey | BRNUMWASAPZVRS-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |