C20H19ClN2O2S — CID 42054679
3-[(2-chlorophenyl)methyl]-2-[[(2S)-oxolan-2-yl]methylsulfanyl]quinazolin-4-one (PubChem CID 42054679) has the molecular formula C20H19ClN2O2S and a molecular weight of 386.90 g/mol. Its IUPAC name is 3-[(2-chlorophenyl)methyl]-2-[[(2S)-oxolan-2-yl]methylsulfanyl]quinazolin-4-one.
| Compound Name | 3-[(2-chlorophenyl)methyl]-2-[[(2S)-oxolan-2-yl]methylsulfanyl]quinazolin-4-one |
|---|---|
| PubChem CID | 42054679 |
| Molecular Formula | C20H19ClN2O2S |
| Molecular Weight | 386.90 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | 3-[(2-chlorophenyl)methyl]-2-[[(2S)-oxolan-2-yl]methylsulfanyl]quinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(SC[C@@H]2CCCO2)n1Cc1ccccc1Cl |
| InChI | InChI=1S/C20H19ClN2O2S/c21-17-9-3-1-6-14(17)12-23-19(24)16-8-2-4-10-18(16)22-20(23)26-13-15-7-5-11-25-15/h1-4,6,8-10,15H,5,7,11-13H2/t15-/m0/s1 |
| InChIKey | MRBNCEULMWNYLU-HNNXBMFYSA-N |
| XLogP | 4.37 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.90 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |