C23H25N3O2S — CID 8015123
N-[4-[(2S)-butan-2-yl]phenyl]-2-(4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylacetamide (PubChem CID 8015123) has the molecular formula C23H25N3O2S and a molecular weight of 407.54 g/mol. Its IUPAC name is N-[4-[(2S)-butan-2-yl]phenyl]-2-(4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylacetamide.
| Compound Name | N-[4-[(2S)-butan-2-yl]phenyl]-2-(4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 8015123 |
| Molecular Formula | C23H25N3O2S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | N-[4-[(2S)-butan-2-yl]phenyl]-2-(4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylacetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2ccc([C@@H](C)CC)cc2)nc2ccccc2c1=O |
| InChI | InChI=1S/C23H25N3O2S/c1-4-14-26-22(28)19-8-6-7-9-20(19)25-23(26)29-15-21(27)24-18-12-10-17(11-13-18)16(3)5-2/h4,6-13,16H,1,5,14-15H2,2-3H3,(H,24,27)/t16-/m0/s1 |
| InChIKey | HTSIPULZOZDSAI-INIZCTEOSA-N |
| XLogP | 4.83 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|