C11H11N3O2S3 — CID 3446883
N-(4-hydroxyphenyl)-2-[(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)sulfanyl]acetamide (PubChem CID 3446883) has the molecular formula C11H11N3O2S3 and a molecular weight of 313.43 g/mol. Its IUPAC name is N-(4-hydroxyphenyl)-2-[(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)sulfanyl]acetamide.
| Compound Name | N-(4-hydroxyphenyl)-2-[(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 3446883 |
| Molecular Formula | C11H11N3O2S3 |
| Molecular Weight | 313.43 g/mol |
| Exact Mass | 313.00 |
| IUPAC Name | N-(4-hydroxyphenyl)-2-[(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)sulfanyl]acetamide |
| SMILES | CSc1nsc(SCC(=O)Nc2ccc(O)cc2)n1 |
| InChI | InChI=1S/C11H11N3O2S3/c1-17-10-13-11(19-14-10)18-6-9(16)12-7-2-4-8(15)5-3-7/h2-5,15H,6H2,1H3,(H,12,16) |
| InChIKey | PRVJQWIQPYMFET-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.43 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|