C11H8Br2N4O3S3 — CID 5105064
N-(2,4-dibromo-6-nitrophenyl)-2-[(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)sulfanyl]acetamide (PubChem CID 5105064) has the molecular formula C11H8Br2N4O3S3 and a molecular weight of 500.22 g/mol. Its IUPAC name is N-(2,4-dibromo-6-nitrophenyl)-2-[(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)sulfanyl]acetamide.
| Compound Name | N-(2,4-dibromo-6-nitrophenyl)-2-[(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 5105064 |
| Molecular Formula | C11H8Br2N4O3S3 |
| Molecular Weight | 500.22 g/mol |
| Exact Mass | 497.81 |
| IUPAC Name | N-(2,4-dibromo-6-nitrophenyl)-2-[(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)sulfanyl]acetamide |
| SMILES | CSc1nsc(SCC(=O)Nc2c(Br)cc(Br)cc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C11H8Br2N4O3S3/c1-21-10-15-11(23-16-10)22-4-8(18)14-9-6(13)2-5(12)3-7(9)17(19)20/h2-3H,4H2,1H3,(H,14,18) |
| InChIKey | HKYCRQYIGXRRPP-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.22 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|