C12H8Br2N4O4S — CID 5194361
N-(2,4-dibromo-6-nitrophenyl)-2-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetamide (PubChem CID 5194361) has the molecular formula C12H8Br2N4O4S and a molecular weight of 464.10 g/mol. Its IUPAC name is N-(2,4-dibromo-6-nitrophenyl)-2-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetamide.
| Compound Name | N-(2,4-dibromo-6-nitrophenyl)-2-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 5194361 |
| Molecular Formula | C12H8Br2N4O4S |
| Molecular Weight | 464.10 g/mol |
| Exact Mass | 461.86 |
| IUPAC Name | N-(2,4-dibromo-6-nitrophenyl)-2-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetamide |
| SMILES | O=C(CSc1nccc(=O)[nH]1)Nc1c(Br)cc(Br)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H8Br2N4O4S/c13-6-3-7(14)11(8(4-6)18(21)22)16-10(20)5-23-12-15-2-1-9(19)17-12/h1-4H,5H2,(H,16,20)(H,15,17,19) |
| InChIKey | CVZHORNYRCIQBO-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 117.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.10 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|